
CAS 887973-80-0
:5-(2,3-Difluorophenyl)-3-pyridinecarboxaldehyde
Description:
5-(2,3-Difluorophenyl)-3-pyridinecarboxaldehyde is an organic compound characterized by its unique structure, which includes a pyridine ring and a difluorophenyl group. The presence of the aldehyde functional group (-CHO) indicates that it can participate in various chemical reactions, such as nucleophilic addition and condensation reactions. This compound is likely to exhibit moderate polarity due to the electronegative fluorine atoms, which can influence its solubility in polar solvents. The difluorophenyl moiety may impart specific electronic properties, potentially affecting its reactivity and interactions with biological targets. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to serve as a building block for more complex molecules. Its synthesis typically involves multi-step organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. Overall, 5-(2,3-Difluorophenyl)-3-pyridinecarboxaldehyde is a compound of interest in both academic and industrial chemistry contexts.
Formula:C12H7F2NO
InChI:InChI=1S/C12H7F2NO/c13-11-3-1-2-10(12(11)14)9-4-8(7-16)5-15-6-9/h1-7H
InChI key:InChIKey=LESWADRWPUFHJQ-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1F)C=2C=C(C=O)C=NC2
Synonyms:- 5-(2,3-Difluorophenyl)-3-pyridinecarboxaldehyde
- 3-Pyridinecarboxaldehyde, 5-(2,3-difluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
