CymitQuimica logo

CAS 887974-02-9

:

5-(4-Chlorophenyl)-3-pyridinemethanol

Description:
5-(4-Chlorophenyl)-3-pyridinemethanol, identified by its CAS number 887974-02-9, is an organic compound characterized by its unique structure, which includes a pyridine ring and a chlorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. The presence of the hydroxymethyl group (-CH2OH) suggests it may participate in hydrogen bonding, influencing its solubility and reactivity. The chlorophenyl moiety can enhance lipophilicity and may also affect biological activity, making this compound of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including purification methods like recrystallization or chromatography. Overall, 5-(4-Chlorophenyl)-3-pyridinemethanol represents a versatile scaffold for further chemical modifications and investigations in various fields, including pharmaceuticals and agrochemicals.
Formula:C12H10ClNO
InChI:InChI=1S/C12H10ClNO/c13-12-3-1-10(2-4-12)11-5-9(8-15)6-14-7-11/h1-7,15H,8H2
InChI key:InChIKey=ZNIWYVUMTWNLTO-UHFFFAOYSA-N
SMILES:C(O)C1=CC(=CN=C1)C2=CC=C(Cl)C=C2
Synonyms:
  • [5-(4-Chlorophenyl)pyridin-3-yl]methanol
  • 5-(4-Chlorophenyl)-3-pyridinemethanol
  • 3-Pyridinemethanol, 5-(4-chlorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.