
CAS 887974-20-1
:5-(2,3-Difluorophenyl)-3-pyridinemethanol
Description:
5-(2,3-Difluorophenyl)-3-pyridinemethanol, with the CAS number 887974-20-1, is an organic compound characterized by its unique structure that includes a pyridine ring and a difluorophenyl group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the hydroxyl (-OH) group, which can engage in hydrogen bonding. The difluorophenyl moiety introduces significant electronegativity, which can influence the compound's reactivity and interaction with biological targets. Additionally, the presence of fluorine atoms often enhances lipophilicity and metabolic stability, making such compounds of interest in medicinal chemistry. The compound may also exhibit specific biological activities, potentially making it a candidate for pharmaceutical applications. Its synthesis and characterization would involve standard organic chemistry techniques, including NMR spectroscopy and mass spectrometry, to confirm its structure and purity. Overall, 5-(2,3-Difluorophenyl)-3-pyridinemethanol represents a class of compounds that can be explored for various chemical and biological applications.
Formula:C12H9F2NO
InChI:InChI=1S/C12H9F2NO/c13-11-3-1-2-10(12(11)14)9-4-8(7-16)5-15-6-9/h1-6,16H,7H2
InChI key:InChIKey=KZEJZLFXNMKCAH-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1F)C=2C=C(CO)C=NC2
Synonyms:- 3-Pyridinemethanol, 5-(2,3-difluorophenyl)-
- 5-(2,3-Difluorophenyl)-3-pyridinemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
