CAS 887974-21-2

5-(4-Methoxyphenyl)-3-pyridinemethanol

Description:

5-(4-Methoxyphenyl)-3-pyridinemethanol, identified by its CAS number 887974-21-2, is an organic compound characterized by its unique molecular structure, which includes a pyridine ring and a methoxy-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential for hydrogen bonding due to the presence of the hydroxyl (-OH) group. The methoxy group contributes to its electron-donating characteristics, which can influence its reactivity and interaction with biological targets. Additionally, the compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds targeting specific receptors or enzymes. As with many organic compounds, the stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 5-(4-Methoxyphenyl)-3-pyridinemethanol represents a versatile scaffold for further chemical exploration and application.

Formula: C₁₃H₁₃NO₂

InChI: InChI=1S/C13H13NO2/c1-16-13-4-2-11(3-5-13)12-6-10(9-15)7-14-8-12/h2-8,15H,9H2,1H3

InChI key: InChIKey=KAZWQVHNKWXKGK-UHFFFAOYSA-N

SMILES: C(O)C1=CC(=CN=C1)C2=CC=C(OC)C=C2

Synonyms:

• 5-(4-Methoxyphenyl)-3-pyridinemethanol
• 3-Pyridinemethanol, 5-(4-methoxyphenyl)-
• [5-(4-Methoxyphenyl)pyridin-3-yl]methanol
• [5-(4-Methoxyphenyl)-3-pyridyl]methanol

(5-(4-Methoxyphenyl)pyridin-3-yl)methanol

CAS: 887974-21-2

Formula: C₁₃H₁₃NO₂

Molecular weight: 215.2478

Ref: IN-DA00GYI8

[5-(4-Methoxyphenyl)-3-pyridyl]methanol

CAS: 887974-21-2

[5-(4-Methoxyphenyl)-3-pyridyl]methanol

Purity: ≥95%

Molecular weight: 215.25g/mol

Ref: 54-OR470284