CAS 887974-28-9
:5-[2-(Trifluoromethyl)phenyl]-3-pyridinemethanol
Description:
5-[2-(Trifluoromethyl)phenyl]-3-pyridinemethanol, with the CAS number 887974-28-9, is a chemical compound characterized by its unique structural features. It contains a pyridine ring, which is a six-membered aromatic ring with one nitrogen atom, and a phenyl group substituted with a trifluoromethyl group, enhancing its lipophilicity and potentially influencing its biological activity. The presence of the hydroxymethyl group (-CH2OH) at the 3-position of the pyridine ring suggests that it may exhibit properties typical of alcohols, such as hydrogen bonding capabilities. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, particularly in the development of pharmaceuticals targeting specific biological pathways. Its trifluoromethyl group can also contribute to increased metabolic stability and bioactivity. Overall, the combination of these functional groups suggests that this compound could have diverse applications in research and development, particularly in the fields of drug discovery and material science.
Formula:C13H10F3NO
InChI:InChI=1S/C13H10F3NO/c14-13(15,16)12-4-2-1-3-11(12)10-5-9(8-18)6-17-7-10/h1-7,18H,8H2
InChI key:InChIKey=SFABOOBJRLONOF-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(C=CC=C1)C=2C=C(CO)C=NC2
Synonyms:- 5-[2-(Trifluoromethyl)phenyl]-3-pyridinemethanol
- 3-Pyridinemethanol, 5-[2-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
