CAS 887974-54-1

[6-(2-fluorophenyl)-3-pyridyl]methanol

Description:

[6-(2-fluorophenyl)-3-pyridyl]methanol, with the CAS number 887974-54-1, is a chemical compound characterized by its unique structure that includes a pyridine ring and a fluorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The hydroxymethyl group (-CH2OH) contributes to its polarity, which can influence its solubility in various solvents. The fluorine atom in the 2-position of the phenyl ring can enhance the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry. Additionally, the presence of the pyridine moiety can impart basicity and influence interactions with biological targets. Overall, [6-(2-fluorophenyl)-3-pyridyl]methanol is a compound that may have applications in pharmaceuticals or as a building block in organic synthesis, owing to its distinctive structural features and potential reactivity.

Formula: C₁₂H₁₀FNO

InChI: InChI=1/C12H10FNO/c13-11-4-2-1-3-10(11)12-6-5-9(8-15)7-14-12/h1-7,15H,8H2

SMILES: c1ccc(c(c1)c1ccc(cn1)CO)F

Synonyms:

• [6-(2-Fluorophenyl)pyridin-3-yl]methanol
• 3-Pyridinemethanol, 6-(2-Fluorophenyl)-

(6-(2-Fluorophenyl)pyridin-3-yl)methanol

CAS: 887974-54-1

Formula: C₁₂H₁₀FNO

Molecular weight: 203.2123

Ref: IN-DA00GYI3

[6-(2-Fluorophenyl)-3-pyridyl]methanol

CAS: 887974-54-1

[6-(2-Fluorophenyl)-3-pyridyl]methanol

Purity: ≥95%

Molecular weight: 203.21g/mol

Ref: 54-PC510061