CymitQuimica logo

CAS 888-61-9

:

2-(4-Bromophenyl)-8-methylimidazo[1,2-a]pyridine

Description:
2-(4-Bromophenyl)-8-methylimidazo[1,2-a]pyridine, with CAS number 888-61-9, is an organic compound that belongs to the class of imidazo[1,2-a]pyridines, which are heterocyclic aromatic compounds. This substance features a fused ring system that includes both imidazole and pyridine moieties, contributing to its unique chemical properties. The presence of a bromophenyl group at the 2-position and a methyl group at the 8-position enhances its molecular complexity and can influence its reactivity and biological activity. Typically, such compounds are of interest in medicinal chemistry due to their potential pharmacological properties, including antitumor and antimicrobial activities. The compound is likely to exhibit moderate to high lipophilicity due to its aromatic structure, which can affect its solubility and permeability in biological systems. Additionally, the bromine substituent may introduce specific reactivity patterns, making it a useful building block in organic synthesis and drug development. Safety and handling precautions should be observed, as with many halogenated organic compounds, due to potential toxicity.
Formula:C14H11BrN2
InChI:InChI=1S/C14H11BrN2/c1-10-3-2-8-17-9-13(16-14(10)17)11-4-6-12(15)7-5-11/h2-9H,1H3
InChI key:InChIKey=GAJMVAOCLIFBTK-UHFFFAOYSA-N
SMILES:CC=1C2=NC(=CN2C=CC1)C3=CC=C(Br)C=C3
Synonyms:
  • Imidazo[1,2-a]pyridine, 2-(p-bromophenyl)-8-methyl-
  • Imidazo[1,2-a]pyridine, 2-(4-bromophenyl)-8-methyl-
  • 2-(4-Bromophenyl)-8-methylimidazo[1,2-a]pyridine
Found 2 products.