CAS 888-71-1
:3,5-diphenyl-1,2,4-oxadiazole
Description:
3,5-Diphenyl-1,2,4-oxadiazole is an organic compound characterized by its oxadiazole ring, which consists of two nitrogen atoms and one oxygen atom within a five-membered ring structure. This compound features two phenyl groups attached to the 3 and 5 positions of the oxadiazole ring, contributing to its aromatic properties and enhancing its stability. It is typically a solid at room temperature and exhibits good thermal stability. The presence of the phenyl groups can also influence its electronic properties, making it useful in various applications, including organic electronics, photonics, and as a potential fluorescent material. Additionally, 3,5-diphenyl-1,2,4-oxadiazole may exhibit interesting photophysical properties, such as fluorescence or phosphorescence, depending on its environment and molecular interactions. Its chemical behavior can be influenced by factors such as solvent polarity and temperature, making it a subject of interest in materials science and organic chemistry research.
Formula:C14H10N2O
InChI:InChI=1/C14H10N2O/c1-3-7-11(8-4-1)13-15-14(17-16-13)12-9-5-2-6-10-12/h1-10H
SMILES:c1ccc(cc1)c1nc(c2ccccc2)on1
Synonyms:- 1,2,4-Oxadiazole, 3,5-Diphenyl-
- 3,5-Diphenyl-[1,2,4]oxadiazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3,5-Diphenyl-[1,2,4]oxadiazole
CAS:3,5-Diphenyl-[1,2,4]oxadiazolePurity:95%Molecular weight:222.24g/mol3,5-Diphenyl-1,2,4-oxadiazole
CAS:3,5-Diphenyl-1,2,4-oxadiazole is a synthetic compound that has the chemical formula C12H10N2O. It is an optical material with orthorhombic symmetry and a melting point of 164 °C. It can be synthesized using the Grignard reaction. 3,5-Diphenyl-1,2,4-oxadiazole is used as a radiolabel for positron emission tomography (PET) imaging in studies of β-amyloid plaques in Alzheimer's disease patients and brain imaging to study the uptake of drugs in cancer cells. 3,5-Diphenyl-1,2,4-oxadiazole has been modified to increase its affinity for β amyloid plaques and increase its diffraction efficiency. The pharmacophore model for this drug is based on aromatic rings with modified electron density at 1' position.
Formula:C14H10N2OPurity:Min. 95%Molecular weight:222.24 g/mol


