CAS 88800-93-5
:1H-Indenol, ethyl-2,3-dihydro-
Description:
1H-Indenol, ethyl-2,3-dihydro- is an organic compound characterized by its bicyclic structure, which includes an indene ring fused with a hydroxyl group. This compound features a hydroxyl (-OH) group attached to the indene framework, contributing to its classification as an alcohol. The presence of the ethyl group enhances its hydrophobic characteristics while also influencing its reactivity and solubility in organic solvents. Typically, compounds like this exhibit moderate volatility and can participate in various chemical reactions, such as oxidation and substitution. The molecular structure allows for potential applications in organic synthesis and as intermediates in the production of pharmaceuticals or agrochemicals. Additionally, the compound's unique properties may lead to interesting interactions in biological systems, although specific biological activity would require further investigation. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C11H14O
InChI:InChI=1/C11H14O/c1-2-11(12)8-7-9-5-3-4-6-10(9)11/h3-6,12H,2,7-8H2,1H3
Synonyms:- 1-ethyl-2,3-dihydro-1H-inden-1-ol
- 1H-Indenol, ethyl-2,3-dihydro-
- Ethylindanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
