CymitQuimica logo

CAS 888019-41-8

:

Benzamide, 4-hydroxy-2-methyl-

Description:
Benzamide, 4-hydroxy-2-methyl- is an organic compound characterized by the presence of a benzamide functional group, which consists of a benzene ring attached to a carbonyl group (C=O) and an amine (NH2). The specific structure of this compound includes a hydroxyl group (-OH) and a methyl group (-CH3) positioned on the benzene ring, which influences its chemical properties and reactivity. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. It may exhibit biological activity, making it of interest in pharmaceutical research. The presence of the hydroxyl and methyl groups can also affect its melting point, boiling point, and overall stability. As with many organic compounds, it is important to handle it with care, following appropriate safety protocols, as it may have specific hazards associated with its use.
Formula:C8H9NO2
InChI:InChI=1S/C8H9NO2/c1-5-4-6(10)2-3-7(5)8(9)11/h2-4,10H,1H3,(H2,9,11)
InChI key:DRVUKSMTYSCDOB-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=C1)O)C(=O)N
Found 3 products.