CAS 88805-35-0
:Prohexadione
Description:
Prohexadione, with the CAS number 88805-35-0, is a chemical compound primarily used as a plant growth regulator. It belongs to the class of compounds known as diketones and is characterized by its ability to inhibit the enzyme gibberellin biosynthesis, which plays a crucial role in plant growth and development. This inhibition leads to reduced stem elongation and promotes compact growth in various crops, making it particularly useful in horticulture and agriculture. Prohexadione is typically applied to crops such as apples and grapes to enhance fruit quality and manage plant height. The compound is generally considered to have low toxicity to humans and animals, but like all agrochemicals, it should be handled with care and in accordance with safety guidelines. Its effectiveness and environmental impact are subjects of ongoing research, emphasizing the importance of responsible usage in agricultural practices.
Formula:C10H12O5
InChI:InChI=1S/C10H12O5/c1-2-6(11)9-7(12)3-5(10(14)15)4-8(9)13/h5,9H,2-4H2,1H3,(H,14,15)
InChI key:InChIKey=BUCOQPHDYUOJSI-UHFFFAOYSA-N
SMILES:C(CC)(=O)C1C(=O)CC(C(O)=O)CC1=O
Synonyms:- 3,5-Dioxo-4-propionylcyclohexanecarboxylic acid
- prohexadione
- 88805-35-0
- Prohexadione
- 3,5-Dioxo-4-propionylcyclohexanecarboxylic acid
- Cyclohexanecarboxylic acid, 3,5-dioxo-4-(1-oxopropyl)-
- 3,5-Dioxo-4-propionylcyclohexancarbons?ure
- 3,5-Dioxo-4-(1-oxopropyl)cyclohexanecarboxylic acid
- DOCHC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Prohexadione
CAS:Prohexadione is a potent inhibitor of protein kinases that has shown promising anticancer properties. It works by inducing apoptosis, or programmed cell death, in cancer cells. Prohexadione is structurally similar to Chinese medicinal analogs and has been shown to inhibit the activity of several kinases involved in tumor growth and progression. This drug has been found to be effective against a variety of human cancers, including breast, lung, and prostate cancer. Prohexadione also has potential use as a urine biomarker for detecting early-stage cancer. This inhibitor shows great promise as a new class of anticancer agents and is currently being studied for its therapeutic potential in treating various types of cancers.
Formula:C10H12O5Purity:Min. 95%Molecular weight:212.2 g/molProhexadione
CAS:Prohexadione: plant growth regulator, inhibits gibberellin synthesis and JMJD2A demethylase, promotes neuron differentiation, applied in agriculture.Formula:C10H12O5Color and Shape:SolidMolecular weight:212.2

