CAS 888069-31-6

2-Ethyl-3-quinolinecarboxylic acid

Description:

2-Ethyl-3-quinolinecarboxylic acid is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features a carboxylic acid functional group (-COOH) at the 3-position and an ethyl group at the 2-position of the quinoline ring. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in synthesizing other chemical entities. Its properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and purity of the sample. Additionally, 2-Ethyl-3-quinolinecarboxylic acid may participate in various chemical reactions, including esterification and amidation, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₂H₁₁NO₂

InChI: InChI=1S/C12H11NO2/c1-2-10-9(12(14)15)7-8-5-3-4-6-11(8)13-10/h3-7H,2H2,1H3,(H,14,15)

InChI key: InChIKey=VTRUZSBNPFFWIO-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(CC)=NC2=C(C1)C=CC=C2

Synonyms:

• 2-Ethyl-3-quinolinecarboxylic acid
• 3-Quinolinecarboxylic acid, 2-ethyl-