CAS 88807-08-3
:1-(Morpholin-4-yl)-2-aminocyclopentane
Description:
1-(Morpholin-4-yl)-2-aminocyclopentane, with the CAS number 88807-08-3, is a chemical compound characterized by its unique structure that includes a cyclopentane ring and a morpholine moiety. This compound features an amino group attached to the cyclopentane, which contributes to its potential as a building block in medicinal chemistry. The morpholine ring, known for its heterocyclic properties, enhances the compound's solubility and biological activity. Typically, compounds like this may exhibit properties such as moderate polarity, which can influence their interaction with biological systems. The presence of both the morpholine and amino groups suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological or psychiatric conditions. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the substituents on the cyclopentane and morpholine rings. Overall, 1-(Morpholin-4-yl)-2-aminocyclopentane represents a versatile structure with implications in various chemical and biological research fields.
Formula:C9H18N2O
InChI:InChI=1/C9H18N2O/c10-8-2-1-3-9(8)11-4-6-12-7-5-11/h8-9H,1-7,10H2
SMILES:C1CC(C(C1)N1CCOCC1)N
Synonyms:- 2-(Morpholin-4-yl)cyclopentanamine
- Cyclopentanamine, 2-(4-Morpholinyl)-
- 2-Morpholinocyclopentanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
