CAS 888070-06-2
:5-(4-Morpholinyl)-3-pyridinemethanol
Description:
5-(4-Morpholinyl)-3-pyridinemethanol, identified by its CAS number 888070-06-2, is a chemical compound characterized by its unique structure, which includes a pyridine ring and a morpholine moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, contributing to its potential biological activity. It is often studied for its role in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with various biological targets. The presence of the hydroxymethyl group enhances its solubility in polar solvents, while the morpholine ring may contribute to its pharmacokinetic properties, such as permeability and metabolic stability. Additionally, the compound may exhibit specific functional properties, including potential antioxidant or anti-inflammatory activities, making it of interest in various research fields. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure.
Formula:C10H14N2O2
InChI:InChI=1S/C10H14N2O2/c13-8-9-5-10(7-11-6-9)12-1-3-14-4-2-12/h5-7,13H,1-4,8H2
InChI key:InChIKey=WUXCKFYQSICLCE-UHFFFAOYSA-N
SMILES:C(O)C1=CC(=CN=C1)N2CCOCC2
Synonyms:- [5-(Morpholin-4-yl)pyridin-3-yl]methanol
- 5-(4-Morpholinyl)-3-pyridinemethanol
- 3-Pyridinemethanol, 5-(4-morpholinyl)-
- (5-Morpholinopyridin-3-yl)methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
