CAS 88816-02-8

Bisphenoxyphenyldithiadiphosphetanedisulfide

Description:

Bisphenoxyphenyldithiadiphosphetanedisulfide, identified by the CAS number 88816-02-8, is a chemical compound that belongs to the class of organophosphorus compounds. It features a unique structure characterized by the presence of sulfur and phosphorus atoms, which contribute to its distinctive chemical properties. This compound is typically used in specialized applications, including as a polymer additive or in the formulation of materials that require enhanced thermal stability and resistance to oxidative degradation. Its molecular structure allows for potential interactions with various substrates, making it valuable in the development of advanced materials. Additionally, the presence of phenoxy groups may impart certain solubility characteristics and reactivity patterns, influencing its behavior in different chemical environments. Safety and handling precautions are essential when working with this compound, as with many organophosphorus substances, due to potential toxicity and environmental impact. Overall, Bisphenoxyphenyldithiadiphosphetanedisulfide exemplifies the complexity and utility of organophosphorus chemistry in modern applications.

Formula: C₂₄H₁₈O₂P₂S₄

InChI: InChI=1/C24H18O2P2S4/c29-27(23-15-11-21(12-16-23)25-19-7-3-1-4-8-19)31-28(30,32-27)24-17-13-22(14-18-24)26-20-9-5-2-6-10-20/h1-18H

SMILES: c1ccc(cc1)Oc1ccc(cc1)P1(=S)SP(=S)(c2ccc(cc2)Oc2ccccc2)S1

Synonyms:

• 2,4-Bis(4-phenoxyphenyl)-1,3-dithia-2,4-diphosphetane-2,4-disulfide
• 2,4-Bis(4-Phenoxyphenyl)-1,3,2,4-Dithiadiphosphetane 2,4-Disulfide

Belleau's Reagent [Sulfurating Reagent]

CAS: 88816-02-8

Formula: C₂₄H₁₈O₂P₂S₄

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 528.59

Ref: 3B-B1517

Belleau's Reagent

CAS: 88816-02-8

Belleau's Reagent is a chemical reagent that reacts with the amine group in the adrenergic receptor. It is used to measure the activation of these receptors by measuring the amount of cAMP produced when exposed to an agonist. This chemical can also be used to synthesize pateamine, which is a drug used in cancer treatments. Belleau's Reagent has been shown to react with other compounds such as chloride, forming trifluoroacetyl chloride, and bond cleavage of n-oxide compounds. In addition, this chemical has been shown to have properties that make it suitable for use in nanomaterials and protein synthesis.

Formula: C₂₄H₁₈O₂P₂S₄

Purity: Min. 95%

Molecular weight: 528.61 g/mol

Ref: 3D-FB61290

Belleaus Reagent [Sulfurating Reagent],

CAS: 88816-02-8

Formula: C₂₄H₁₈O₂P₂S₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 528.6060

Ref: IN-DA003O06