CAS 88820-44-4
:7-chloro-2H-pyrimido[1,2-b]pyridazin-2-one
Description:
7-Chloro-2H-pyrimido[1,2-b]pyridazin-2-one is a heterocyclic compound characterized by its fused pyrimidine and pyridazine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 7-position enhances its reactivity and potential biological activity. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents, reflecting its polar functional groups. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of nitrogen atoms that can participate in hydrogen bonding and coordination with biological targets. The compound may also display interesting electronic properties, making it a candidate for studies in materials science. Additionally, its stability under various conditions is an important characteristic for practical applications. Overall, 7-chloro-2H-pyrimido[1,2-b]pyridazin-2-one is a versatile compound with potential implications in various fields, including drug discovery and materials development.
Formula:C7H4ClN3O
InChI:InChI=1/C7H4ClN3O/c8-5-1-2-6-9-7(12)3-4-11(6)10-5/h1-4H
SMILES:c1cc2nc(=O)ccn2nc1Cl
Synonyms:- 2H-pyrimido[1,2-b]pyridazin-2-one, 7-chloro-
- 7-Chloro-2H-pyrimido[1,2-b]pyridazin-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
