CAS 88829-82-7
:1-Boc-1,8-diaminooctane
Description:
1-Boc-1,8-diaminooctane, also known by its CAS number 88829-82-7, is a chemical compound characterized by the presence of a Boc (tert-butyloxycarbonyl) protecting group attached to a diaminooctane backbone. This compound features two amino groups (-NH2) located at the terminal ends of an octane chain, which contributes to its potential as a building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The Boc group serves to protect the amino functionalities during chemical reactions, allowing for selective modifications. 1-Boc-1,8-diaminooctane is typically a solid at room temperature and is soluble in polar organic solvents. Its structure allows for various applications, including peptide synthesis and the formation of complex molecules. The presence of the long aliphatic chain enhances its lipophilicity, which can influence its biological activity and interaction with cellular membranes. Overall, this compound is valuable in synthetic organic chemistry due to its functional groups and versatility in further transformations.
Formula:C13H28N2O2
InChI:InChI=1/C13H28N2O2/c1-13(2,3)17-12(16)15-11-9-7-5-4-6-8-10-14/h4-11,14H2,1-3H3,(H,15,16)
SMILES:CC(C)(C)OC(=NCCCCCCCCN)O
Synonyms:- Tert-Butyl (8-Aminooctyl)Carbamate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Carbamic acid,N-(8-aminooctyl)-, 1,1-dimethylethyl ester
CAS:Formula:C13H28N2O2Purity:97%Color and Shape:SolidMolecular weight:244.3736Ref: IN-DA008AT7
1g55.00€5g119.00€10g169.00€1kgTo inquire25g328.00€250gTo inquire500gTo inquire100mg25.00€250mg28.00€Octane-1,8-diamine, N-BOC protected
CAS:Octane-1,8-diamine, N-BOC protectedFormula:C13H28N2O2Purity:99%Color and Shape: yellow low melting solidMolecular weight:244.37g/mol1-Boc-1,8-diaminooctane
CAS:1-Boc-1,8-diaminooctane is a polymerase that is used in the synthesis of DNA. It has been shown to be able to cleave supercoiled DNA and bind to acidic surfaces. This compound is fluorescent and can form covalent adducts with nucleic acids. 1-Boc-1,8-diaminooctane also has a piperidine group, which can act as a linker for other molecules such as anthracene. 1-Boc-1,8-diaminooctane is a neutral pH compound that reacts well with biomolecules.Formula:C13H28N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:244.37 g/molTERT-BUTYL (8-AMINOOCTYL)CARBAMATE
CAS:Formula:C13H28N2O2Purity:95%Color and Shape:SolidMolecular weight:244.3791-Boc-1,8-diaminooctane
CAS:Controlled Product<p>Applications 1-Boc-1,8-diaminooctane<br></p>Formula:C13H28N2O2Color and Shape:NeatMolecular weight:244.37tert-Butyl (8-aminooctyl)carbamate
CAS:tert-Butyl (8-aminooctyl)carbamate (1-Boc-1,8-diaminooctane) serves as a linker for PROTAC synthesis. This compound features an alkane chain with a terminal amine protected by a Boc group. The amine group can react with carboxylic acids, active NHS esters, and carbonyl groups such as ketones and aldehydes. The Boc group can be removed under mild acidic conditions to yield a free amine.Formula:C13H28N2O2Color and Shape:SolidMolecular weight:244.374





