CAS 88830-90-4
:L-Glutaminyl-L-glutamic acid
Description:
L-Glutaminyl-L-glutamic acid, also known as a dipeptide composed of the amino acids L-glutamine and L-glutamic acid, is a compound that plays a significant role in various biochemical processes. It is characterized by its structure, which features a peptide bond linking the two amino acids. This dipeptide is soluble in water, reflecting the polar nature of its constituent amino acids. L-Glutaminyl-L-glutamic acid is involved in neurotransmission and metabolic pathways, particularly in the central nervous system, where it may influence synaptic plasticity and cognitive functions. Its properties include being non-toxic and having potential applications in nutrition and pharmaceuticals, particularly in formulations aimed at enhancing cognitive performance or supporting metabolic health. Additionally, it can serve as a substrate for various enzymatic reactions. As with many peptides, its stability can be affected by factors such as pH and temperature, which are important considerations in its handling and storage.
Formula:C10H17N3O6
InChI:InChI=1S/C10H17N3O6/c11-5(1-3-7(12)14)9(17)13-6(10(18)19)2-4-8(15)16/h5-6H,1-4,11H2,(H2,12,14)(H,13,17)(H,15,16)(H,18,19)/t5-,6-/m0/s1
InChI key:InChIKey=OWOFCNWTMWOOJJ-WDSKDSINSA-N
SMILES:[C@H](NC([C@H](CCC(N)=O)N)=O)(CCC(O)=O)C(O)=O
Synonyms:- L-Glutamic acid, L-glutaminyl-
- 63: PN: US20070191366 TABLE: 5 claimed protein
- Glutamic acid, N-L-glutaminyl-
- L-Glutamic acid, N-L-glutaminyl-
- L-Glutaminyl-L-glutamic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
L-Glutaminyl-L-glutamic Acid
CAS:Controlled ProductFormula:C10H17N3O6Color and Shape:NeatMolecular weight:275.259H-Gln-Glu-OH
CAS:H-Gln-Glu-OH is a pharmacological inhibitor that blocks the epidermal growth factor receptor (EGFR) and inhibits cell proliferation. It has been shown to inhibit endothelial cell proliferation in vitro. H-Gln-Glu-OH also inhibits the tyrosine kinase activity of EGFR, which is necessary for the activation of phospholipase C. This inhibition prevents atherogenic cell functions and has been shown to inhibit the growth of human epidermoid carcinoma in tissue culture.Formula:C10H17N3O6Purity:Min. 95%Molecular weight:275.26 g/molH-Gln-Glu-OH
CAS:Bachem ID: 4014165.
Formula:C10H17N3O6Purity:≥ 98%Color and Shape:White PowderMolecular weight:275.26



