CymitQuimica logo

CAS 88835-95-4

:

N-(3-piperidin-1-ylbutyl)-1H-indazol-3-amine

Description:
N-(3-piperidin-1-ylbutyl)-1H-indazol-3-amine, with the CAS number 88835-95-4, is a chemical compound characterized by its unique structure, which includes an indazole core and a piperidine moiety. This compound typically exhibits properties associated with both amines and heterocycles, such as potential basicity due to the presence of nitrogen atoms. The piperidine ring contributes to its potential as a pharmacological agent, possibly influencing its interaction with biological targets. The indazole structure may impart specific reactivity and stability characteristics, making it of interest in medicinal chemistry. Additionally, the compound's solubility, melting point, and other physical properties would depend on its molecular interactions and the presence of functional groups. Its synthesis and applications may be explored in various fields, including drug development, where it could serve as a lead compound or a building block for more complex molecules. Overall, the compound's characteristics suggest potential utility in therapeutic contexts, although specific biological activities would require further investigation.
Formula:C16H24N4
InChI:InChI=1/C16H24N4/c1-13(20-11-5-2-6-12-20)9-10-17-16-14-7-3-4-8-15(14)18-19-16/h3-4,7-8,13H,2,5-6,9-12H2,1H3,(H2,17,18,19)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.