CAS 88837-66-5
:1-butyl-4-{[4-({4-[(1-butylpyridinium-4-yl)amino]phenyl}carbamoyl)phenyl]amino}quinolinium
Description:
1-Butyl-4-{[4-({4-[(1-butylpyridinium-4-yl)amino]phenyl}carbamoyl)phenyl]amino}quinolinium, with CAS number 88837-66-5, is a complex organic compound characterized by its multi-functional structure, which includes a quinolinium core and various substituents that enhance its solubility and reactivity. This compound typically exhibits properties such as amphiphilicity due to the presence of both hydrophobic (butyl groups) and hydrophilic (pyridinium) moieties, making it suitable for applications in drug delivery and as a potential dye or sensor in biochemical assays. Its structure suggests potential interactions with biological systems, which may lead to interesting pharmacological properties. Additionally, the presence of multiple aromatic rings may contribute to its electronic properties, allowing for potential applications in organic electronics or photonics. The compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations for its practical applications.
Formula:C35H39N5O
InChI:InChI=1/C35H37N5O/c1-3-5-22-39-24-19-31(20-25-39)36-28-15-17-30(18-16-28)38-35(41)27-11-13-29(14-12-27)37-33-21-26-40(23-6-4-2)34-10-8-7-9-32(33)34/h7-21,24-26H,3-6,22-23H2,1-2H3,(H,38,41)/p+2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-butyl-4-{[4-({4-[(1-butylpyridinium-4-yl)amino]phenyl}carbamoyl)phenyl]amino}quinolinium
CAS:Formula:C35H39N5OMolecular weight:545.7171
