
CAS 88842-15-3
:[3-(1-Ethoxyethoxy-κO)propyl-κC]lithium
Description:
The chemical substance known as [3-(1-Ethoxyethoxy-κO)propyl-κC]lithium, with the CAS number 88842-15-3, is an organolithium compound characterized by its lithium atom bonded to a propyl group that is further substituted with an ethoxyethoxy moiety. This structure imparts unique properties, such as high reactivity and the ability to act as a strong nucleophile, making it useful in various organic synthesis applications. Organolithium compounds are typically highly polar and can engage in a range of reactions, including nucleophilic additions and deprotonation of weak acids. The presence of the ethoxyethoxy group enhances solubility in organic solvents, facilitating its use in synthetic chemistry. Additionally, due to the presence of lithium, this compound may exhibit properties such as low volatility and stability under anhydrous conditions, although it is sensitive to moisture and air. Proper handling and storage in inert atmospheres are essential to maintain its reactivity and prevent degradation.
Formula:C7H15LiO2
InChI:InChI=1S/C7H15O2.Li/c1-4-6-9-7(3)8-5-2;/h7H,1,4-6H2,2-3H3;/q-1;+1
InChI key:InChIKey=YBOJGJXSYDWZBR-UHFFFAOYSA-N
SMILES:C(OCC)(C)O1CC[CH2-][Li+]1
Synonyms:- Propane, 1-(1-ethoxyethoxy)-, lithium complex
- 3-(1-Ethoxyethoxy)propyl lithium
- Lithium, [3-(1-ethoxyethoxy)propyl]-
- Lithium, [3-(1-ethoxyethoxy-κO)propyl-κC]-
- [3-(1-Ethoxyethoxy-κO)propyl-κC]lithium
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
