CAS 88847-78-3
:L-tyrosyl-L-methionylglycyl-L-prolyl-L-phenylalanyl-L-leucine
Description:
L-tyrosyl-L-methionylglycyl-L-prolyl-L-phenylalanyl-L-leucine, identified by the CAS number 88847-78-3, is a synthetic peptide composed of six amino acids: tyrosine, methionine, glycine, proline, phenylalanine, and leucine. This peptide exhibits characteristics typical of proteins, including a specific sequence that influences its structure and function. It is likely to have a hydrophobic nature due to the presence of amino acids like leucine and phenylalanine, which can affect its solubility in aqueous environments. The presence of proline may introduce rigidity into the peptide structure, potentially influencing its biological activity. Peptides like this one can play roles in various biological processes, including signaling pathways and enzyme regulation. Additionally, the unique combination of amino acids may confer specific properties, such as antioxidant activity or interactions with receptors. Overall, the characteristics of this peptide are determined by its amino acid composition and sequence, which dictate its three-dimensional conformation and biological function.
Formula:C36H50N6O8S
InChI:InChI=1/C36H50N6O8S/c1-22(2)18-29(36(49)50)41-34(47)28(20-23-8-5-4-6-9-23)40-35(48)30-10-7-16-42(30)31(44)21-38-33(46)27(15-17-51-3)39-32(45)26(37)19-24-11-13-25(43)14-12-24/h4-6,8-9,11-14,22,26-30,43H,7,10,15-21,37H2,1-3H3,(H,38,46)(H,39,45)(H,40,48)(H,41,47)(H,49,50)/t26-,27-,28-,29-,30-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phorphin
CAS:Phorphin is the fourth repeating peptide in prodinorphin.Formula:C36H50N6O8SColor and Shape:SolidMolecular weight:726.88
