CymitQuimica logo

CAS 88848-52-6

:

disulfanediylbis(benzene-2,1-diylcarbonyliminopropane-3,1-diyl) dioctanoate

Description:
Disulfanediylbis(benzene-2,1-diylcarbonyliminopropane-3,1-diyl) dioctanoate, identified by its CAS number 88848-52-6, is a complex organic compound characterized by its unique molecular structure that includes disulfide linkages and multiple functional groups. This compound features two benzene rings connected to a central disulfide moiety, which contributes to its potential reactivity and stability. The presence of carbonyl and imine functional groups suggests that it may exhibit properties such as chelation and coordination with metal ions, making it of interest in various chemical applications. Additionally, the dioctanoate moiety indicates that it may possess amphiphilic characteristics, potentially allowing it to interact with both polar and non-polar environments. Such properties could make it useful in fields like materials science, pharmaceuticals, or as a surfactant. However, detailed studies on its physical and chemical properties, such as solubility, melting point, and reactivity, would be necessary to fully understand its behavior in different environments.
Formula:C36H52N2O6S2
InChI:InChI=1/C36H52N2O6S2/c1-3-5-7-9-11-23-33(39)43-27-17-25-37-35(41)29-19-13-15-21-31(29)45-46-32-22-16-14-20-30(32)36(42)38-26-18-28-44-34(40)24-12-10-8-6-4-2/h13-16,19-22H,3-12,17-18,23-28H2,1-2H3,(H,37,41)(H,38,42)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.