CAS 88849-65-4
:3,9-di(ethylidene)-2,4,8,10-tetraoxaspiro[5.5]undecane; hexane-1,6-diol; [4-(hydroxymethyl)cyclohexyl]methanol
Description:
The chemical substance with the name "3,9-di(ethylidene)-2,4,8,10-tetraoxaspiro[5.5]undecane; hexane-1,6-diol; [4-(hydroxymethyl)cyclohexyl]methanol" and CAS number 88849-65-4 is a complex organic compound characterized by its unique spirocyclic structure, which incorporates multiple functional groups, including ether and alcohol moieties. This compound features a spiro arrangement that contributes to its rigidity and potential for specific interactions in various applications. The presence of ethylidene groups suggests it may exhibit reactivity typical of alkenes, while the hexane-1,6-diol component introduces hydroxyl groups that enhance solubility in polar solvents and may facilitate hydrogen bonding. The hydroxymethyl group on the cyclohexyl ring further adds to its potential for forming intermolecular interactions. Overall, this compound's structural complexity and functional diversity may render it useful in fields such as materials science, pharmaceuticals, or as a building block in organic synthesis, although specific applications would depend on its reactivity and stability under various conditions.
Formula:C25H46O8
InChI:InChI=1/C11H16O4.C8H16O2.C6H14O2/c1-3-9-12-5-11(6-13-9)7-14-10(4-2)15-8-11;9-5-7-1-2-8(6-10)4-3-7;7-5-3-1-2-4-6-8/h3-4H,5-8H2,1-2H3;7-10H,1-6H2;7-8H,1-6H2/b9-3-,10-4-;;
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,9-diethylidene-2,4,8,10-tetraoxaspiro[5.5]undecane; hexane-1,6-diol; [4-(hydroxymethyl)cyclohexyl]methanol
CAS:Formula:C25H46O8Molecular weight:474.6279
