CymitQuimica logo

CAS 88852-60-2

:

3-(5,7-diamino-3H-[1,2,3]triazolo[4,5-d]pyrimidin-3-yl)-5-(hydroxymethyl)cyclopentane-1,2-diol

Description:
The chemical substance known as "3-(5,7-diamino-3H-[1,2,3]triazolo[4,5-d]pyrimidin-3-yl)-5-(hydroxymethyl)cyclopentane-1,2-diol," with the CAS number 88852-60-2, is a complex organic compound characterized by its unique structural features. It contains a cyclopentane ring substituted with hydroxymethyl and a triazolopyrimidine moiety, which contributes to its potential biological activity. The presence of amino groups suggests that it may engage in hydrogen bonding and participate in various biochemical interactions. This compound is likely to exhibit solubility in polar solvents due to the hydroxymethyl and amino functionalities. Its structural complexity may confer specific pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. The compound's stability, reactivity, and potential applications would depend on its specific interactions within biological systems, as well as its synthesis and purification methods. Further studies would be necessary to elucidate its full range of characteristics and potential uses in research or clinical settings.
Formula:C10H15N7O3
InChI:InChI=1/C10H15N7O3/c11-8-5-9(14-10(12)13-8)17(16-15-5)4-1-3(2-18)6(19)7(4)20/h3-4,6-7,18-20H,1-2H2,(H4,11,12,13,14)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.