CAS 88867-96-3

(2R)-1-[(4-nitrophenyl)sulfonyl]pyrrolidine-2-carboxylate

Description:

The chemical substance known as (2R)-1-[(4-nitrophenyl)sulfonyl]pyrrolidine-2-carboxylate, with the CAS number 88867-96-3, is characterized by its specific structural features and functional groups. It contains a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and a carboxylate group that contributes to its acidic properties. The presence of a sulfonyl group attached to a 4-nitrophenyl moiety indicates that this compound has significant electrophilic characteristics, making it potentially reactive in various chemical reactions. The nitro group on the phenyl ring enhances the compound's polarity and can influence its solubility in different solvents. Additionally, the stereochemistry indicated by the (2R) configuration suggests that the compound has specific spatial arrangements that may affect its biological activity and interactions with other molecules. Overall, this compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development.

Formula: C₁₁H₁₁N₂O₆S

InChI: InChI=1/C11H12N2O6S/c14-11(15)10-2-1-7-12(10)20(18,19)9-5-3-8(4-6-9)13(16)17/h3-6,10H,1-2,7H2,(H,14,15)/p-1/t10-/m1/s1

SMILES: C1C[C@H](C(=O)[O-])N(C1)S(=O)(=O)c1ccc(cc1)N(=O)=O

1-[(4-Nitrophenyl)sulfonyl]pyrrolidine-2-carboxylic acid

CAS: 88867-96-3

Formula: C₁₁H₁₂N₂O₆S

Purity: 97%

Molecular weight: 300.2878

Ref: IN-DA004A4D