
CAS 88867-97-4
:(2S)-1-[(4-Chlorophenyl)sulfonyl]-2-pyrrolidinecarbonyl chloride
Description:
The chemical substance known as (2S)-1-[(4-Chlorophenyl)sulfonyl]-2-pyrrolidinecarbonyl chloride, with the CAS number 88867-97-4, is a synthetic organic compound characterized by its specific functional groups and stereochemistry. It features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is substituted with a sulfonyl group attached to a 4-chlorophenyl moiety, indicating the presence of a chlorine atom on the phenyl ring. The carbonyl chloride functional group suggests that this compound is likely reactive, particularly in nucleophilic substitution reactions. The (2S) designation indicates that the compound has a specific stereochemistry at the second carbon of the pyrrolidine ring, which can influence its biological activity and interactions. This compound may be of interest in medicinal chemistry and drug development due to its potential pharmacological properties, although specific applications would depend on further research and characterization. Safety and handling precautions should be observed, as compounds containing sulfonyl and carbonyl chloride groups can be hazardous.
Formula:C11H11Cl2NO3S
InChI:InChI=1S/C11H11Cl2NO3S/c12-8-3-5-9(6-4-8)18(16,17)14-7-1-2-10(14)11(13)15/h3-6,10H,1-2,7H2/t10-/m0/s1
InChI key:InChIKey=XYDBDXIAMSSBIB-JTQLQIEISA-N
SMILES:S(=O)(=O)(N1[C@H](C(Cl)=O)CCC1)C2=CC=C(Cl)C=C2
Synonyms:- 2-Pyrrolidinecarbonyl chloride, 1-[(4-chlorophenyl)sulfonyl]-, (S)-
- 2-Pyrrolidinecarbonyl chloride, 1-[(4-chlorophenyl)sulfonyl]-, (2S)-
- (2S)-1-[(4-Chlorophenyl)sulfonyl]-2-pyrrolidinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Pyrrolidinecarbonyl chloride, 1-[(4-chlorophenyl)sulfonyl]-, (S)-
CAS:Formula:C11H11Cl2NO3SMolecular weight:308.1809
