CymitQuimica logo

CAS 888720-61-4

:

4,5-Dichloropyrrolo[2,1-f][1,2,4]triazine

Description:
4,5-Dichloropyrrolo[2,1-f][1,2,4]triazine is a heterocyclic compound characterized by its fused ring structure, which incorporates both pyrrole and triazine moieties. This compound features two chlorine substituents at the 4 and 5 positions of the pyrrolo ring, contributing to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the triazine ring enhances its stability and may influence its electronic properties, making it a candidate for use in materials science and organic electronics. Additionally, the compound's unique structure may exhibit interesting biological activities, warranting further investigation into its potential as a lead compound in drug discovery. Its synthesis typically involves multi-step organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography to confirm its structure and purity. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental concerns associated with chlorine-containing substances.
Formula:C6H3Cl2N3
InChI:InChI=1S/C6H3Cl2N3/c7-4-1-2-11-5(4)6(8)9-3-10-11/h1-3H
InChI key:InChIKey=QUFRWQJHIBMRGA-UHFFFAOYSA-N
SMILES:ClC=1C=2N(N=CN1)C=CC2Cl
Synonyms:
  • Pyrrolo[2,1-f][1,2,4]triazine, 4,5-dichloro-
  • 4,5-Dichloropyrrolo[2,1-f][1,2,4]triazine
Found 1 products.