CAS 88876-88-4
:α-(1-Aziridinylmethyl)-2-nitro-1H-imidazole-1-ethanol
Description:
α-(1-Aziridinylmethyl)-2-nitro-1H-imidazole-1-ethanol, with the CAS number 88876-88-4, is a chemical compound that features a unique structure combining an aziridine ring and an imidazole moiety. This compound is characterized by its nitro group, which contributes to its reactivity and potential biological activity. The presence of the aziridine ring suggests that it may exhibit interesting properties related to ring-opening reactions, making it a candidate for various synthetic applications. Additionally, the hydroxyl group in the ethanol portion of the molecule can participate in hydrogen bonding, influencing its solubility and interaction with other substances. This compound may be of interest in medicinal chemistry, particularly for its potential use in drug development, as compounds with similar structures have been explored for their antimicrobial and anticancer properties. Overall, α-(1-Aziridinylmethyl)-2-nitro-1H-imidazole-1-ethanol represents a versatile structure with potential applications in various fields of chemistry and pharmacology.
Formula:C8H12N4O3
InChI:InChI=1S/C8H12N4O3/c13-7(5-10-3-4-10)6-11-2-1-9-8(11)12(14)15/h1-2,7,13H,3-6H2
InChI key:InChIKey=OEWYWFJWBZNJJG-UHFFFAOYSA-N
SMILES:C(C(CN1CC1)O)N2C(N(=O)=O)=NC=C2
Synonyms:- RSU 1069
- α-(1-Aziridinylmethyl)-2-nitro-1H-imidazole-1-ethanol
- NSC 347503
- 1H-Imidazole-1-ethanol, α-(1-aziridinylmethyl)-2-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
