CymitQuimica logo

CAS 88882-29-5

:

3,5-Dimethyl-2(3H)-benzoxazolethione

Description:
3,5-Dimethyl-2(3H)-benzoxazolethione, identified by its CAS number 88882-29-5, is a heterocyclic compound featuring a benzoxazole ring with thione functionality. This compound is characterized by the presence of two methyl groups at the 3 and 5 positions of the benzoxazole moiety, which can influence its chemical reactivity and solubility. The thione group contributes to its potential as a nucleophile and may participate in various chemical reactions, including those involving electrophiles. Typically, compounds of this nature exhibit interesting biological activities, making them of interest in medicinal chemistry and material science. The presence of the benzoxazole structure often imparts fluorescent properties, which can be useful in applications such as dyes or sensors. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, 3,5-Dimethyl-2(3H)-benzoxazolethione is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C9H9NOS
InChI:InChI=1S/C9H9NOS/c1-6-3-4-8-7(5-6)10(2)9(12)11-8/h3-5H,1-2H3
InChI key:InChIKey=WJRBNMRCNVIWFB-UHFFFAOYSA-N
SMILES:CN1C=2C(OC1=S)=CC=C(C)C2
Synonyms:
  • 2(3H)-Benzoxazolethione, 3,5-dimethyl-
  • 3,5-Dimethyl-1,3-benzoxazole-2-thione
  • 3,5-Dimethyl-2(3H)-benzoxazolethione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.