CAS 88883-73-2

2-(4-methyl-1H-imidazol-2-yl)ethanamine dihydrochloride

Description:

2-(4-methyl-1H-imidazol-2-yl)ethanamine dihydrochloride, with the CAS number 88883-73-2, is a chemical compound characterized by its imidazole ring structure, which contributes to its biological activity. This substance is a dihydrochloride salt, indicating that it contains two hydrochloric acid molecules associated with the amine group, enhancing its solubility in water. The presence of the 4-methyl group on the imidazole ring influences its electronic properties and steric hindrance, potentially affecting its interaction with biological targets. As an amine, it can participate in hydrogen bonding, making it relevant in various chemical and pharmaceutical applications. The compound may exhibit properties such as being a potential ligand in coordination chemistry or a precursor in the synthesis of other biologically active molecules. Its specific characteristics, including melting point, solubility, and reactivity, would depend on the conditions under which it is studied or utilized. Overall, this compound is of interest in medicinal chemistry and related fields due to its structural features and potential applications.

Formula: C₆H₁₃Cl₂N₃

InChI: InChI=1/C6H11N3.2ClH/c1-5-4-8-6(9-5)2-3-7;;/h4H,2-3,7H2,1H3,(H,8,9);2*1H

SMILES: Cc1cnc(CCN)[nH]1.Cl.Cl

Synonyms:

• 1H-Imidazole-2-ethanamine, 4-methyl-, hydrochloride (1:2)
• 2-(4-Methyl-1H-imidazol-2-yl)ethanamine dihydrochloride

2-(5-Methyl-1H-imidazol-2-yl)ethanamine dihydrochloride

CAS: 88883-73-2

Formula: C₆H₁₃Cl₂N₃

Molecular weight: 198.0935

Ref: IN-DA00H30S