CAS 88885-92-1
:1,7-diazabicyclo[5.5.4]hexadecane
Description:
1,7-Diazabicyclo[5.5.4]hexadecane, also known by its CAS number 88885-92-1, is a bicyclic organic compound featuring a unique structure that includes two nitrogen atoms within a bicyclic framework. This compound is characterized by its high basicity due to the presence of the diazabicyclic structure, which allows it to act as a strong nucleophile and a potential catalyst in various chemical reactions. It is typically a colorless to pale yellow solid at room temperature and is soluble in polar organic solvents. The compound's unique structure contributes to its potential applications in organic synthesis, particularly in the formation of complex molecules. Additionally, its properties may be influenced by factors such as temperature and solvent interactions. As with many nitrogen-containing compounds, it may exhibit interesting reactivity patterns, making it a subject of interest in both academic and industrial chemistry research. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C14H28N2
InChI:InChI=1/C14H28N2/c1-3-9-15-11-5-2-6-12-16(10-4-1)14-8-7-13-15/h1-14H2
Synonyms:- 1,7-Diazabicyclo[5.5.4]hexadecane
- 1,7-Diazabicyclo(5.5.4)hexadecane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
