CAS 888972-50-7
:9H-fluoren-9-ylmethyl (2S)-2-methylpiperazine-1-carboxylate
Description:
9H-fluoren-9-ylmethyl (2S)-2-methylpiperazine-1-carboxylate is a chemical compound characterized by its unique structure, which includes a fluorenyl group and a piperazine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in medicinal chemistry. The presence of the fluorenyl group often imparts stability and lipophilicity, while the piperazine ring can enhance biological activity due to its ability to interact with various biological targets. The (2S)-2-methyl configuration indicates chirality, which may influence the compound's pharmacological properties and interactions. This compound may be of interest in drug development, particularly in the context of designing agents that target specific receptors or enzymes. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be analyzed using methods such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. Overall, this compound represents a versatile scaffold for further exploration in chemical and pharmaceutical research.
Formula:C20H22N2O2
InChI:InChI=1/C20H22N2O2/c1-14-12-21-10-11-22(14)20(23)24-13-19-17-8-4-2-6-15(17)16-7-3-5-9-18(16)19/h2-9,14,19,21H,10-13H2,1H3/t14-/m0/s1
SMILES:C[C@H]1CNCCN1C(=O)OCC1c2ccccc2c2ccccc12
Synonyms:- (S)-1-N-Fmoc-2-methyl-piperazine
- 9H-Fluoren-9-ylmethyl (2S)-2-methylpiperazine-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
