CAS 889-10-1

2-[(4-Methoxyphenyl)methylene]butanedioic acid

Description:

2-[(4-Methoxyphenyl)methylene]butanedioic acid, also known by its CAS number 889-10-1, is an organic compound characterized by its structure, which features a butanedioic acid backbone with a methylene bridge connecting a 4-methoxyphenyl group. This compound typically exhibits properties associated with both carboxylic acids and aromatic compounds, including moderate solubility in polar solvents due to the presence of carboxylic acid functional groups. The methoxy group enhances its electron-donating ability, potentially influencing its reactivity and interactions in various chemical environments. It may participate in hydrogen bonding due to the carboxylic acid moieties, which can affect its physical properties such as melting and boiling points. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical and chemical research. Its unique structure allows for potential applications in organic synthesis and as a building block in the development of more complex molecules.

Formula: C₁₂H₁₂O₅

InChI: InChI=1S/C12H12O5/c1-17-10-4-2-8(3-5-10)6-9(12(15)16)7-11(13)14/h2-6H,7H2,1H3,(H,13,14)(H,15,16)

InChI key: InChIKey=HZRZZPNSLQASGS-UHFFFAOYSA-N

SMILES: C(=CC1=CC=C(OC)C=C1)(CC(O)=O)C(O)=O

Synonyms:

• Succinic acid, (p-methoxybenzylidene)-
• 2-[(4-Methoxyphenyl)methylene]butanedioic acid
• Butanedioic acid, [(4-methoxyphenyl)methylene]-
• (2E)-2-(4-methoxybenzylidene)butanedioic acid
• Butanedioic acid, 2-[(4-methoxyphenyl)methylene]-
• 2-[(4-methoxyphenyl)methylidene]butanedioic acid
• (2Z)-2-(4-methoxybenzylidene)butanedioic acid

2-(4-Methoxybenzylidene)succinic acid

CAS: 889-10-1

Formula: C₁₂H₁₂O₅

Molecular weight: 236.2207

Ref: IN-DA00496O

2-(4-methoxybenzylidene)succinic acid

CAS: 889-10-1

2-(4-methoxybenzylidene)succinic acid

Purity: 95%

Molecular weight: 236.22067g/mol

Ref: 54-OR29180