CAS 88901-37-5
:Mogroside III-E
Description:
Mogroside III-E is a natural glycoside derived from the fruit of the Siraitia grosvenorii, commonly known as monk fruit. It is primarily recognized for its intense sweetness, which is significantly greater than that of sucrose, making it a popular natural sweetener in food and beverage applications. Mogroside III-E is characterized by its low-calorie content, as it is not metabolized by the body in the same way as traditional sugars, thus contributing to its appeal for those seeking healthier alternatives. Chemically, it consists of a complex structure featuring multiple sugar moieties attached to a triterpenoid backbone, which contributes to its sweet taste profile. Additionally, mogrosides, including III-E, possess potential antioxidant and anti-inflammatory properties, which have garnered interest in the fields of nutrition and health. Its stability under heat and acidic conditions makes it suitable for various culinary uses. Overall, Mogroside III-E represents a significant advancement in the search for natural, low-calorie sweeteners.
Formula:C48H82O19
InChI:InChI=1S/C48H82O19/c1-21(9-13-31(45(4,5)61)66-43-40(37(58)34(55)27(20-51)64-43)67-42-39(60)36(57)33(54)26(19-50)63-42)22-15-16-46(6)28-12-10-23-24(48(28,8)29(52)17-47(22,46)7)11-14-30(44(23,2)3)65-41-38(59)35(56)32(53)25(18-49)62-41/h10,21-22,24-43,49-61H,9,11-20H2,1-8H3/t21-,22-,24-,25-,26-,27-,28+,29-,30+,31-,32-,33-,34-,35+,36+,37+,38-,39-,40-,41+,42+,43+,46+,47-,48+/m1/s1
InChI key:InChIKey=QATISCJMIITVAB-CNEPTXDISA-N
SMILES:C[C@]12[C@]([C@@]3(C)[C@](C)(C[C@H]1O)[C@@]([C@@H](CC[C@@H](O[C@H]4[C@H](O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@@H](CO)O4)C(C)(C)O)C)(CC3)[H])(CC=C6[C@]2(CC[C@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)C6(C)C)[H])[H]
Synonyms:- (3β,9β,10α,11α,24R)-3-(β-<span class="text-smallcaps">D</smallcap>-Glucopyranosyloxy)-11,25-dihydroxy-9-methyl-19-norlanost-5-en-24-yl 2-O-β-<smallcap>D</smallcap>-glucopyranosyl-β-<smallcap>D</span>-glucopyranoside
- Mogroside III-E
- β-<span class="text-smallcaps">D</smallcap>-Glucopyranoside, (3β,9β,10α,11α,24R)-3-(β-<smallcap>D</smallcap>-glucopyranosyloxy)-11,25-dihydroxy-9-methyl-19-norlanost-5-en-24-yl 2-O-β-<smallcap>D</span>-glucopyranosyl-
- β-D-Glucopyranoside, (3β,9β,10α,11α,24R)-3-(β-D-glucopyranosyloxy)-11,25-dihydroxy-9-methyl-19-norlanost-5-en-24-yl 2-O-β-D-glucopyranosyl-
- (3β,9β,10α,11α,24R)-3-(β-D-Glucopyranosyloxy)-11,25-dihydroxy-9-methyl-19-norlanost-5-en-24-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
(2S,3R,4S,5S,6R)-2-(((2S,3R,4S,5S,6R)-4,5-Dihydroxy-2-(((3R,6R)-2-Hydroxy-6-((3S,8S,9R,10R,11R,13R,14S,17R)-11-Hydroxy-4,4,9,13,14-Pentamethyl-3-(((2R,3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(Hydroxymethyl)Te
CAS:<p>(2S,3R,4S,5S,6R)-2-(((2S,3R,4S,5S,6R)-4,5-Dihydroxy-2-(((3R,6R)-2-Hydroxy-6-((3S,8S,9R,10R,11R,13R,14S,17R)-11-Hydroxy-4,4,9,13,14-Pentamethyl-3-(((2R,3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(Hydroxymethyl)Te</p>Purity:98%Molecular weight:963.15g/molMogroside III-E
CAS:<p>Mogroside III-E is a cucurbitane-type compound isolated from Siraitia grosvenorii, has anti-inflammatory activity, it attenuates LPS-induced acute lung injury</p>Formula:C48H82O19Purity:99.73% - 99.85%Color and Shape:SolidMolecular weight:963.15Mogroside III-E
CAS:<p>Mogroside III-E is a high-intensity sweetening compound, which is a natural product derived from the fruit of Siraitia grosvenorii, commonly known as monk fruit or luo han guo. This compound is one of the primary mogrosides present in the fruit, contributing to its intensely sweet taste, often perceived as up to 300 times sweeter than sucrose.</p>Formula:C48H82O19Purity:Min. 95%Molecular weight:963.15 g/mol






