CymitQuimica logo

CAS 88909-82-4

:

9,10-dihydro-8H-benzo[a]pyren-7-one oxime

Description:
9,10-Dihydro-8H-benzo[a]pyren-7-one oxime, with the CAS number 88909-82-4, is a chemical compound that belongs to the class of polycyclic aromatic hydrocarbons (PAHs) and is characterized by its complex aromatic structure. This compound features a benzo[a]pyrene backbone, which is known for its potential carcinogenic properties. The presence of the oxime functional group (-C=N-OH) indicates that it has undergone a modification that can influence its reactivity and biological activity. Typically, compounds like this may exhibit properties such as fluorescence and may participate in various chemical reactions, including nucleophilic additions. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. Due to its structural characteristics, it may also be of interest in studies related to environmental chemistry, toxicology, and the development of new materials or pharmaceuticals. However, specific safety and handling guidelines should be followed due to the potential hazards associated with PAHs.
Formula:C20H15NO
InChI:InChI=1/C20H15NO/c22-21-18-6-2-5-15-16-10-9-13-4-1-3-12-7-8-14(11-17(15)18)20(16)19(12)13/h1,3-4,7-11,22H,2,5-6H2/b21-18+
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.