CAS 88912-23-6

2,6-Difluoroisonicotinic acid

Description:

2,6-Difluoroisonicotinic acid is a fluorinated derivative of isonicotinic acid, characterized by the presence of two fluorine atoms at the 2 and 6 positions of the pyridine ring. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. It is typically a white to off-white solid, soluble in polar solvents such as water and alcohols, owing to its polar functional groups. The presence of fluorine atoms can enhance the compound's lipophilicity and influence its biological activity, making it of interest in medicinal chemistry and drug design. 2,6-Difluoroisonicotinic acid may exhibit various properties, including antimicrobial and anti-inflammatory activities, depending on its interactions with biological targets. Its molecular structure allows for potential applications in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. As with many fluorinated compounds, it may also exhibit unique physical and chemical properties, such as increased stability and altered reactivity compared to its non-fluorinated counterparts.

Formula: C₆H₃F₂NO₂

InChI: InChI=1S/C6H3F2NO2/c7-4-1-3(6(10)11)2-5(8)9-4/h1-2H,(H,10,11)

InChI key: InChIKey=UDPPKJDEENEJQG-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(F)N=C(F)C1

Synonyms:

• 2,6-Difluoro-4-pyridinecarboxylic acid
• 2,6-Difluoro-4-pyridinecarboxylicacid
• 2,6-Difluoroisonicotinic acid
• 4-Pyridinecarboxylic Acid, 2,6-Difluoro-

2,6-Difluoroisonicotinic acid

CAS: 88912-23-6

Formula: C₆H₃F₂NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 159.0903

Ref: IN-DA00490Q

2,6-Difluoroisonicotinic acid

CAS: 88912-23-6

2,6-Difluoroisonicotinic acid

Formula: C₆H₃F₂NO₂

Purity: 97%

Color and Shape: white solid

Molecular weight: 159.09g/mol

Ref: 54-PC1426

2,6-Difluoro-isonicotinic acid

CAS: 88912-23-6

Formula: C₆H₃F₂NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 159.092

Ref: 10-F049540