CAS 88912-39-4

6-[4-(Phenylmethyl)phenyl]-1,2,4-triazolo[4,3-b]pyridazin-3-amine

Description:

6-[4-(Phenylmethyl)phenyl]-1,2,4-triazolo[4,3-b]pyridazin-3-amine is a chemical compound characterized by its complex structure, which includes a triazole ring fused to a pyridazine moiety. This compound features a phenylmethyl group attached to a phenyl ring, contributing to its aromatic character and potentially influencing its biological activity. The presence of the triazole and pyridazine rings suggests that it may exhibit interesting pharmacological properties, as these structures are often associated with various biological activities, including anti-inflammatory and antimicrobial effects. The amine functional group can also play a crucial role in the compound's reactivity and solubility. The molecular structure indicates that it may participate in hydrogen bonding, which can affect its interactions with biological targets. Overall, this compound's unique arrangement of functional groups and rings makes it a subject of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its specific properties and potential applications.

Formula: C₁₈H₁₅N₅

InChI: InChI=1S/C18H15N5/c19-18-21-20-17-11-10-16(22-23(17)18)15-8-6-14(7-9-15)12-13-4-2-1-3-5-13/h1-11H,12H2,(H2,19,21)

InChI key: InChIKey=LTAQQIKAFDIJCU-UHFFFAOYSA-N

SMILES: NC=1N2C(C=CC(=N2)C3=CC=C(CC4=CC=CC=C4)C=C3)=NN1

Synonyms:

• 6-[4-(Phenylmethyl)phenyl]-1,2,4-triazolo[4,3-b]pyridazin-3-amine
• 1,2,4-Triazolo[4,3-b]pyridazin-3-amine, 6-[4-(phenylmethyl)phenyl]-

1,2,4-Triazolo[4,3-b]pyridazin-3-amine, 6-[4-(phenylmethyl)phenyl]-

CAS: 88912-39-4

Formula: C₁₈H₁₅N₅

Molecular weight: 301.3452

Ref: IN-DA00490P