CAS 889126-33-4

methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate

Description:

Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate, identified by its CAS number 889126-33-4, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a chloropyrimidine moiety. This compound typically exhibits properties associated with both heterocyclic and aliphatic compounds, including moderate solubility in organic solvents and potential reactivity due to the presence of functional groups such as the carboxylate ester. The chloropyrimidine component may impart specific biological activities, making it of interest in pharmaceutical research, particularly in the development of novel therapeutic agents. The presence of the methyl ester group suggests potential for hydrolysis under basic or acidic conditions, leading to the formation of the corresponding carboxylic acid. Overall, this compound's unique structural features contribute to its potential applications in medicinal chemistry and related fields.

Formula: C₁₁H₁₄ClN₃O₂

InChI: InChI=1/C11H14ClN3O2/c1-17-10(16)8-3-6-15(7-4-8)9-2-5-13-11(12)14-9/h2,5,8H,3-4,6-7H2,1H3

SMILES: COC(=O)C1CCN(CC1)c1ccnc(Cl)n1

Methyl 1-(2-chloropyrimidin-4-yl)piperidine-4-carboxylate

CAS: 889126-33-4

Formula: C₁₁H₁₄ClN₃O₂

Purity: 95%

Molecular weight: 255.7008

Ref: IN-DA00496G