CymitQuimica logo

CAS 88915-33-7

:

4-Piperidinamine, 3-methyl-1-(phenylmethyl)-, trans-

Description:
4-Piperidinamine, 3-methyl-1-(phenylmethyl)-, trans- is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a methyl group at the 3-position and a phenylmethyl group at the 1-position of the piperidine ring, contributing to its unique properties. The "trans" designation indicates the specific stereochemistry of the molecule, which can influence its biological activity and interactions. It is typically classified as an amine due to the presence of the amino group (-NH2) attached to the piperidine ring. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many organic compounds, safety and handling precautions should be observed, particularly due to potential toxicity associated with amines.
Formula:C13H20N2
InChI:InChI=1/C13H20N2/c1-11-9-15(8-7-13(11)14)10-12-5-3-2-4-6-12/h2-6,11,13H,7-10,14H2,1H3/t11-,13-/s2
InChI key:InChIKey=MGTFEKWKCLDVNN-BJBPJPDTNA-N
SMILES:C(N1C[C@H](C)[C@@H](N)CC1)C2=CC=CC=C2
Synonyms:
  • 4-Piperidinamine, 3-methyl-1-(phenylmethyl)-, trans-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.