
CAS 88915-69-9
:Boron, [(ethylamino)carbonyl]dihydro(N-methylmethanamine)-, (T-4)-
Description:
The chemical substance known as Boron, [(ethylamino)carbonyl]dihydro(N-methylmethanamine)-, commonly referred to by its CAS number 88915-69-9, is a boron-containing compound that features a complex molecular structure. It is characterized by the presence of a boron atom bonded to a carbonyl group, which is further substituted with an ethylamino group and a dihydro-N-methylmethanamine moiety. This compound exhibits properties typical of organoboron compounds, including potential applications in organic synthesis and medicinal chemistry due to its unique reactivity and ability to form stable complexes. The presence of nitrogen-containing functional groups suggests potential biological activity, making it of interest in pharmaceutical research. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, this substance represents a fascinating area of study within the field of organometallic chemistry, with implications for both industrial and academic research.
Formula:C5H15BN2O
InChI:InChI=1S/C5H15BN2O/c1-4-7-5(9)6-8(2)3/h8H,4,6H2,1-3H3,(H,7,9)
InChI key:InChIKey=CSOIAJXZYFSFSL-UHFFFAOYSA-N
SMILES:[B+3]([C-](NCC)=O)([NH](C)C)([H-])[H-]
Synonyms:- Formamide, N-ethyl-, boron complex
- Boron, [(ethylamino)carbonyl]dihydro(N-methylmethanamine)-, (T-4)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Boron, [(ethylamino)carbonyl]dihydro(N-methylmethanamine)-, (T-4)-
CAS:Formula:C5H13BN2OMolecular weight:127.9805
