
CAS 88919-99-7
:2-(2,3-Dihydro-1H-indol-1-yl)-1-phenylethanone
Description:
2-(2,3-Dihydro-1H-indol-1-yl)-1-phenylethanone, with the CAS number 88919-99-7, is an organic compound characterized by its indole and ketone functional groups. This substance features a phenyl group attached to a carbonyl (ketone) moiety, which is further linked to a dihydroindole structure. The presence of the indole ring contributes to its potential biological activity, as indoles are known for their occurrence in various natural products and pharmaceuticals. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with neuroactive or anti-inflammatory properties. Additionally, the compound's unique structure may allow for interactions with biological targets, making it of interest in drug discovery and development. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C16H15NO
InChI:InChI=1S/C16H15NO/c18-16(14-7-2-1-3-8-14)12-17-11-10-13-6-4-5-9-15(13)17/h1-9H,10-12H2
InChI key:InChIKey=CDCQPBZDRNRZSJ-UHFFFAOYSA-N
SMILES:C(C(=O)C1=CC=CC=C1)N2C=3C(CC2)=CC=CC3
Synonyms:- 2-(2,3-Dihydro-1H-indol-1-yl)-1-phenylethan-1-one
- 2-(2,3-Dihydro-1H-indol-1-yl)-1-phenylethanone
- Ethanone, 2-(2,3-dihydro-1H-indol-1-yl)-1-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
