CymitQuimica logo

CAS 88920-24-5

:

4-Methoxybenzyloxyacetic acid

Description:
4-Methoxybenzyloxyacetic acid, with the CAS number 88920-24-5, is an organic compound characterized by its structure, which includes a methoxy group and a benzyloxy group attached to an acetic acid moiety. This compound typically appears as a white to off-white solid and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the aromatic groups. It possesses functional groups that can participate in various chemical reactions, making it useful in organic synthesis and medicinal chemistry. The presence of the methoxy group can influence its reactivity and biological activity, potentially enhancing lipophilicity and modulating interactions with biological targets. Additionally, the compound may exhibit specific pharmacological properties, although detailed studies would be necessary to elucidate its biological effects. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 4-Methoxybenzyloxyacetic acid represents a versatile compound in chemical research and development.
Formula:C10H12O4
InChI:InChI=1/C10H12O4/c1-13-9-4-2-8(3-5-9)6-14-7-10(11)12/h2-5H,6-7H2,1H3,(H,11,12)
InChI key:XNXTXCKLOBWPQA-UHFFFAOYSA-N
SMILES:COc1ccc(cc1)COCC(=O)O
Found 5 products.