CAS 88930-16-9
:11-Oxomogrol
Description:
11-Oxomogrol, with the CAS number 88930-16-9, is a chemical compound that belongs to the class of natural products known as terpenoids. It is derived from the plant species of the genus *Mogrosia*, which is known for its sweet-tasting compounds. The structure of 11-Oxomogrol features a ketone functional group, which contributes to its reactivity and potential biological activity. This compound is of interest in various fields, including pharmacology and food science, due to its potential health benefits and sweetening properties. It may exhibit antioxidant, anti-inflammatory, and antimicrobial activities, making it a subject of research for therapeutic applications. Additionally, its natural origin and potential as a low-calorie sweetener align with current trends in health-conscious consumer products. However, further studies are necessary to fully understand its mechanisms of action and safety profile. As with many natural compounds, the extraction and purification processes can influence its characteristics and efficacy.
Formula:C30H50O4
InChI:InChI=1S/C30H50O4/c1-18(9-13-24(32)27(4,5)34)19-15-16-28(6)22-12-10-20-21(11-14-23(31)26(20,2)3)30(22,8)25(33)17-29(19,28)7/h10,18-19,21-24,31-32,34H,9,11-17H2,1-8H3/t18-,19-,21-,22+,23+,24-,28+,29-,30+/m1/s1
InChI key:InChIKey=FPMQKXQOBKDVHF-DJHQPCGUSA-N
SMILES:C[C@]12[C@]3([C@](C)([C@]4(C(=CC3)C(C)(C)[C@@H](O)CC4)[H])C(=O)C[C@]1(C)[C@@]([C@@H](CC[C@H](C(C)(C)O)O)C)(CC2)[H])[H]
Synonyms:- (3β,9β,10α,24R)-3,24,25-Trihydroxy-9-methyl-19-norlanost-5-en-11-one
- 19-Norlanost-5-en-11-one, 3,24,25-trihydroxy-9-methyl-, (3β,9β,10α,24R)-
- Bryodulcosigenin
- 11-Oxomogrol
- NSC 710352
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
