CymitQuimica logo

CAS 889360-84-3

:

Pyridine, 2-(bromomethyl)-3-methoxy-

Description:
Pyridine, 2-(bromomethyl)-3-methoxy- is an organic compound characterized by a pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This specific compound features a bromomethyl group (-CH2Br) at the 2-position and a methoxy group (-OCH3) at the 3-position of the pyridine ring. The presence of these substituents influences its chemical reactivity and properties. Pyridine derivatives are often used in various chemical syntheses and can exhibit biological activity, making them of interest in medicinal chemistry. The bromomethyl group can serve as a reactive site for further chemical modifications, while the methoxy group can affect the compound's solubility and polarity. Additionally, the compound may exhibit distinct physical properties such as boiling and melting points, which are influenced by the molecular structure and the presence of functional groups. Overall, this compound is a valuable building block in organic synthesis and may have applications in pharmaceuticals and agrochemicals.
Formula:C7H8BrNO
InChI:InChI=1S/C7H8BrNO/c1-10-7-3-2-4-9-6(7)5-8/h2-4H,5H2,1H3
InChI key:RTKBCDCUFUKBII-UHFFFAOYSA-N
SMILES:COC1=C(N=CC=C1)CBr
Found 4 products.