CymitQuimica logo

CAS 88938-23-2

:

Ethanol, 2-phenoxy-, 1-(4-aminobenzoate)

Description:
Ethanol, 2-phenoxy-, 1-(4-aminobenzoate), with the CAS number 88938-23-2, is an organic compound characterized by its structure, which includes an ethanol moiety, a phenoxy group, and a 4-aminobenzoate functional group. This compound typically exhibits properties associated with both alcohols and aromatic amines, such as moderate solubility in polar solvents like water and organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, particularly as a drug delivery agent or in the synthesis of biologically active compounds. The presence of the amino group may impart basic characteristics, while the phenoxy group can enhance lipophilicity, influencing the compound's interaction with biological membranes. Additionally, the compound may exhibit specific reactivity due to the functional groups present, making it a candidate for further chemical modifications. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, this compound's unique combination of functional groups positions it as a versatile entity in chemical research and application.
Formula:C15H15NO3
InChI:InChI=1S/C15H15NO3/c16-13-8-6-12(7-9-13)15(17)19-11-10-18-14-4-2-1-3-5-14/h1-9H,10-11,16H2
InChI key:InChIKey=XKTXFHFQGLRJKG-UHFFFAOYSA-N
SMILES:C(OCCOC1=CC=CC=C1)(=O)C2=CC=C(N)C=C2
Synonyms:
  • 4-(2-Phenoxyethoxycarbonyl)aniline
  • 2-Phenoxyethyl 4-aminobenzoate
  • Ethanol, 2-phenoxy-, 1-(4-aminobenzoate)
  • Ethanol, 2-phenoxy-, 4-aminobenzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.