
CAS 88938-24-3
:Ethanol, 2-(hexyloxy)-, 1-(4-aminobenzoate)
Description:
Ethanol, 2-(hexyloxy)-, 1-(4-aminobenzoate), with the CAS number 88938-24-3, is an organic compound that features both an alcohol and an amine functional group, making it a versatile molecule in various chemical applications. It is characterized by its long hydrocarbon chain, which contributes to its hydrophobic properties, while the presence of the ethanol and amine groups imparts some hydrophilicity. This dual nature allows it to interact with both polar and nonpolar environments, making it useful in formulations such as surfactants or emulsifiers. The compound may exhibit moderate solubility in water due to the ethanol moiety, while the hexyloxy group enhances its lipophilicity. Additionally, the presence of the 4-aminobenzoate moiety suggests potential applications in pharmaceuticals or as a dye, given the biological activity often associated with amine-substituted aromatic compounds. Overall, this compound's unique structure allows for diverse applications in chemical synthesis, materials science, and potentially in medicinal chemistry.
Formula:C15H23NO3
InChI:InChI=1S/C15H23NO3/c1-2-3-4-5-10-18-11-12-19-15(17)13-6-8-14(16)9-7-13/h6-9H,2-5,10-12,16H2,1H3
InChI key:InChIKey=VLYHQISWYRHIGD-UHFFFAOYSA-N
SMILES:C(OCCOCCCCCC)(=O)C1=CC=C(N)C=C1
Synonyms:- Ethanol, 2-(hexyloxy)-, 4-aminobenzoate
- Ethanol, 2-(hexyloxy)-, 1-(4-aminobenzoate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
