
CAS 88945-44-2
:3,5-Dihydro-3-(2-thiazolyl)-4H-imidazol-4-imine
Description:
3,5-Dihydro-3-(2-thiazolyl)-4H-imidazol-4-imine is a heterocyclic organic compound characterized by its imidazole and thiazole functional groups. This compound features a five-membered imidazole ring, which is known for its aromatic properties and ability to participate in various chemical reactions, including coordination with metal ions. The presence of the thiazole moiety introduces additional reactivity and can influence the compound's biological activity. Typically, such compounds exhibit a range of pharmacological properties, making them of interest in medicinal chemistry. The molecular structure allows for potential interactions with biological targets, which may lead to applications in drug development. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. As with many heterocycles, the electronic properties imparted by the nitrogen and sulfur atoms can affect the compound's behavior in chemical reactions and its interactions with other molecules. Overall, 3,5-Dihydro-3-(2-thiazolyl)-4H-imidazol-4-imine represents a class of compounds with significant potential in various chemical and biological applications.
Formula:C6H6N4S
InChI:InChI=1S/C6H6N4S/c7-5-3-8-4-10(5)6-9-1-2-11-6/h1-2,4,7H,3H2
InChI key:InChIKey=FRAFKJMTUAOAHV-UHFFFAOYSA-N
SMILES:N=C1N(C=NC1)C2=NC=CS2
Synonyms:- 4H-Imidazol-4-imine, 3,5-dihydro-3-(2-thiazolyl)-
- 3,5-Dihydro-3-(2-thiazolyl)-4H-imidazol-4-imine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
