CAS 889451-15-4

B-(5-Amino-3-thienyl)boronic acid

Description:

B-(5-Amino-3-thienyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group and a thienyl ring substituted with an amino group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The thienyl moiety contributes to its potential biological activity, as thiophene derivatives are often explored for their pharmacological properties. B-(5-Amino-3-thienyl)boronic acid may also participate in Suzuki-Miyaura cross-coupling reactions, which are valuable in the formation of carbon-carbon bonds. Its solubility is generally influenced by the presence of the boronic acid group, which can enhance its interaction with polar solvents. Additionally, the amino group can engage in hydrogen bonding, further affecting its reactivity and interaction with biological targets. Overall, this compound represents a versatile building block in both synthetic and medicinal chemistry contexts.

Formula: C₄H₆BNO₂S

InChI: InChI=1S/C4H6BNO2S/c6-4-1-3(2-9-4)5(7)8/h1-2,7-8H,6H2

InChI key: InChIKey=QCSFWCBEQYEHCL-UHFFFAOYSA-N

SMILES: B(O)(O)C=1C=C(N)SC1

Synonyms:

• (5-Aminothiophen-3-yl)boronic acid
• B-(5-Amino-3-thienyl)boronic acid
• Boronic acid, (5-amino-3-thienyl)-
• Boronic acid, B-(5-amino-3-thienyl)-