CAS 889453-83-2
:(4aS,6S,7S,8R,8aR)-8-allyloxy-7-azido-6-(4-methoxyphenoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine
Description:
The chemical substance with the name "(4aS,6S,7S,8R,8aR)-8-allyloxy-7-azido-6-(4-methoxyphenoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine" and CAS number "889453-83-2" is a complex organic compound characterized by its multi-ring structure and various functional groups. It features a hexahydropyrano[3,2-d][1,3]dioxine core, which contributes to its potential biological activity. The presence of an azido group (-N3) and an allyloxy group (-O-CH2-CH=CH2) suggests reactivity that could be exploited in synthetic applications or biological interactions. Additionally, the compound contains a methoxyphenoxy moiety, which may enhance its solubility and influence its pharmacological properties. The stereochemistry indicated by the specific configuration at multiple chiral centers suggests that the compound may exhibit unique interactions in biological systems, potentially affecting its efficacy and safety profile. Overall, this compound's intricate structure and functional groups position it as a candidate for further research in medicinal chemistry and related fields.
Formula:C23H25N3O6
InChI:InChI=1/C23H25N3O6/c1-3-13-28-21-19(25-26-24)23(30-17-11-9-16(27-2)10-12-17)31-18-14-29-22(32-20(18)21)15-7-5-4-6-8-15/h3-12,18-23H,1,13-14H2,2H3/t18-,19-,20-,21+,22?,23+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Methoxyphenyl 3-O-Allyl-2-azido-4,6-O-benzylidene-2-deoxy-β-D-galactopyranoside
CAS:Formula:C23H25N3O6Purity:95%Color and Shape:SolidMolecular weight:439.46114-Methoxyphenyl 3-O-Allyl-2-azido-4,6-O-benzylidene-2-deoxy-β-D-galactopyranoside
CAS:4-Methoxyphenyl 3-O-Allyl-2-azido-4,6-O-benzylidene-2-deoxy-β-D-galactopyranosidePurity:>95.0%4-Methoxyphenyl 3-O-Allyl-2-azido-4,6-O-benzylidene-2-deoxy-β-D-galactopyranoside
CAS:Formula:C23H25N3O6Purity:>95.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:439.474-Methoxyphenyl 3-O-allyl-2-azido-4,6-O-benzylidene-2-deoxy-b-D-galactopyranoside
CAS:<p>4-Methoxyphenyl 3-O-allyl-2-azido-4,6-O-benzylidene-2-deoxy-b-D-galactopyranoside is a glycosaminoglycan. It is used in the treatment of cancer to prevent metastasis and as an antiviral agent. 4MOP has been shown to inhibit the growth of virus in tissue culture by preventing the formation of new virus particles. The antiviral activity may be due to its ability to inhibit the replication of viruses at an early stage of the process. 4MOP also inhibits coagulation and antibody production, which are important for fighting infection.</p>Formula:C23H25N3O6Purity:Min. 95%Molecular weight:439.46 g/mol




